ChemNet > CAS > 58327-75-6 3-aminothieno[2,3-b]pyridine-2-carboxylic acid
58327-75-6 3-aminothieno[2,3-b]pyridine-2-carboxylic acid
| product Name |
3-aminothieno[2,3-b]pyridine-2-carboxylic acid |
| CAS No |
58327-75-6 |
| Synonyms |
3-Aminothieno(2,3-b)pyridine-2-carboxylic acid; NSC 284503 |
| Molecular Formula |
C8H6N2O2S |
| Molecular Weight |
194.2104 |
| InChI |
InChI=1/C8H6N2O2S/c9-5-4-2-1-3-10-7(4)13-6(5)8(11)12/h1-3H,9H2,(H,11,12) |
| Molecular Structure |
![58327-75-6 3-aminothieno[2,3-b]pyridine-2-carboxylic acid](https://images-a.chemnet.com/suppliers/chembase/142/14216.gif)
|
| Density |
1.604g/cm3 |
| Melting point |
278℃ |
| Boiling point |
453.3°C at 760 mmHg |
| Refractive index |
1.799 |
| Flash point |
228°C |
| Vapour Pressur |
5.22E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
